C13H18O3 — CID 134860602
(3aR,5aS,8aS,8bR)-3a,5a-dimethyl-4,6,7,8,8a,8b-hexahydro-3H-cyclopenta[g][2]benzofuran-1,5-dione (PubChem CID 134860602) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3aR,5aS,8aS,8bR)-3a,5a-dimethyl-4,6,7,8,8a,8b-hexahydro-3H-cyclopenta[g][2]benzofuran-1,5-dione.
| Compound Name | (3aR,5aS,8aS,8bR)-3a,5a-dimethyl-4,6,7,8,8a,8b-hexahydro-3H-cyclopenta[g][2]benzofuran-1,5-dione |
|---|---|
| PubChem CID | 134860602 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3aR,5aS,8aS,8bR)-3a,5a-dimethyl-4,6,7,8,8a,8b-hexahydro-3H-cyclopenta[g][2]benzofuran-1,5-dione |
| SMILES | C[C@]12COC(=O)[C@@H]1[C@@H]1CCC[C@]1(C)C(=O)C2 |
| InChI | InChI=1S/C13H18O3/c1-12-6-9(14)13(2)5-3-4-8(13)10(12)11(15)16-7-12/h8,10H,3-7H2,1-2H3/t8-,10-,12-,13-/m0/s1 |
| InChIKey | MGEFBAGKCYTMNK-JBSCMGISSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |