About 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one
4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one (PubChem CID 13486070) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one.
Molecular Properties
| Compound Name | 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one |
| PubChem CID | 13486070 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one |
| SMILES | CC(C)C(=O)CCC1(C)OCCO1 |
| InChI | InChI=1S/C10H18O3/c1-8(2)9(11)4-5-10(3)12-6-7-13-10/h8H,4-7H2,1-3H3 |
| InChIKey | RBFYBLFGCOYDGX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one?
The IUPAC name of 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one (CID 13486070) is 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one.
What is the SMILES notation for 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one?
The canonical SMILES for 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one is CC(C)C(=O)CCC1(C)OCCO1.
What is the InChIKey of 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one?
The InChIKey is RBFYBLFGCOYDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-8(2)9(11)4-5-10(3)12-6-7-13-10/h8H,4-7H2,1-3H3.
What are the key properties of 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one?
4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one has a molecular weight of 186.25 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-3-one is sourced from PubChem (CID 13486070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).