C12H22O3 — CID 134895321
1-(2-ethyl-1,3-dioxolan-2-yl)-5-methylhexan-3-one (PubChem CID 134895321) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-dioxolan-2-yl)-5-methylhexan-3-one.
| Compound Name | 1-(2-ethyl-1,3-dioxolan-2-yl)-5-methylhexan-3-one |
|---|---|
| PubChem CID | 134895321 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1-(2-ethyl-1,3-dioxolan-2-yl)-5-methylhexan-3-one |
| SMILES | CCC1(CCC(=O)CC(C)C)OCCO1 |
| InChI | InChI=1S/C12H22O3/c1-4-12(14-7-8-15-12)6-5-11(13)9-10(2)3/h10H,4-9H2,1-3H3 |
| InChIKey | GIFOCBUHRBKPIP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |