C14H26O3 — CID 11791366
7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylheptan-3-one (PubChem CID 11791366) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylheptan-3-one.
| Compound Name | 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylheptan-3-one |
|---|---|
| PubChem CID | 11791366 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 7-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylheptan-3-one |
| SMILES | CC1(C)OCC(CCCCC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H26O3/c1-13(2,3)12(15)9-7-6-8-11-10-16-14(4,5)17-11/h11H,6-10H2,1-5H3 |
| InChIKey | WIJFXWICOCXKFJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|