C16H30O3 — CID 134978685
6-(2-methyl-1,3-dioxolan-2-yl)dodecan-5-one (PubChem CID 134978685) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 6-(2-methyl-1,3-dioxolan-2-yl)dodecan-5-one.
| Compound Name | 6-(2-methyl-1,3-dioxolan-2-yl)dodecan-5-one |
|---|---|
| PubChem CID | 134978685 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 6-(2-methyl-1,3-dioxolan-2-yl)dodecan-5-one |
| SMILES | CCCCCCC(C(=O)CCCC)C1(C)OCCO1 |
| InChI | InChI=1S/C16H30O3/c1-4-6-8-9-10-14(15(17)11-7-5-2)16(3)18-12-13-19-16/h14H,4-13H2,1-3H3 |
| InChIKey | JQYGBMQEASIXDP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|