C8H16O5 — CID 134860895
(2S,3R,4R)-1-(methoxymethoxy)hex-5-ene-2,3,4-triol (PubChem CID 134860895) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is (2S,3R,4R)-1-(methoxymethoxy)hex-5-ene-2,3,4-triol.
| Compound Name | (2S,3R,4R)-1-(methoxymethoxy)hex-5-ene-2,3,4-triol |
|---|---|
| PubChem CID | 134860895 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2S,3R,4R)-1-(methoxymethoxy)hex-5-ene-2,3,4-triol |
| SMILES | C=C[C@@H](O)[C@@H](O)[C@@H](O)COCOC |
| InChI | InChI=1S/C8H16O5/c1-3-6(9)8(11)7(10)4-13-5-12-2/h3,6-11H,1,4-5H2,2H3/t6-,7+,8-/m1/s1 |
| InChIKey | YGRDETNZEKEFNT-GJMOJQLCSA-N |
| XLogP | -1.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|