C9H8IRf- — CID 134860933
6-iodo-1,2,3,5-tetrahydroinden-5-ide;rutherfordium (PubChem CID 134860933) has the molecular formula C9H8IRf- and a molecular weight of 510.07 g/mol. Its IUPAC name is 6-iodo-1,2,3,5-tetrahydroinden-5-ide;rutherfordium.
| Compound Name | 6-iodo-1,2,3,5-tetrahydroinden-5-ide;rutherfordium |
|---|---|
| PubChem CID | 134860933 |
| Molecular Formula | C9H8IRf- |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 6-iodo-1,2,3,5-tetrahydroinden-5-ide;rutherfordium |
| SMILES | Ic1[c-]cc2c(c1)CCC2.[Rf] |
| InChI | InChI=1S/C9H8I.Rf/c10-9-5-4-7-2-1-3-8(7)6-9;/h4,6H,1-3H2;/q-1; |
| InChIKey | PNEMVFHJHBHBOJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|