About (3S)-3-methyldodeca-6,10-diynal
(3S)-3-methyldodeca-6,10-diynal (PubChem CID 134861085) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is (3S)-3-methyldodeca-6,10-diynal.
Molecular Properties
| Compound Name | (3S)-3-methyldodeca-6,10-diynal |
| PubChem CID | 134861085 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (3S)-3-methyldodeca-6,10-diynal |
| SMILES | CC#CCCC#CCC[C@H](C)CC=O |
| InChI | InChI=1S/C13H18O/c1-3-4-5-6-7-8-9-10-13(2)11-12-14/h12-13H,5-6,9-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | CHQJUDRYIBDKIO-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-methyldodeca-6,10-diynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyldodeca-6,10-diynal?
The IUPAC name of (3S)-3-methyldodeca-6,10-diynal (CID 134861085) is (3S)-3-methyldodeca-6,10-diynal.
What is the SMILES notation for (3S)-3-methyldodeca-6,10-diynal?
The canonical SMILES for (3S)-3-methyldodeca-6,10-diynal is CC#CCCC#CCC[C@H](C)CC=O.
What is the InChIKey of (3S)-3-methyldodeca-6,10-diynal?
The InChIKey is CHQJUDRYIBDKIO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H18O/c1-3-4-5-6-7-8-9-10-13(2)11-12-14/h12-13H,5-6,9-11H2,1-2H3/t13-/m0/s1.
What are the key properties of (3S)-3-methyldodeca-6,10-diynal?
(3S)-3-methyldodeca-6,10-diynal has a molecular weight of 190.29 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyldodeca-6,10-diynal is sourced from PubChem (CID 134861085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).