C12H17O5- — CID 134861195
(1Z,4E)-1-ethoxy-2-ethoxycarbonyl-6-oxohepta-1,4-dien-1-olate (PubChem CID 134861195) has the molecular formula C12H17O5- and a molecular weight of 241.26 g/mol. Its IUPAC name is (1Z,4E)-1-ethoxy-2-ethoxycarbonyl-6-oxohepta-1,4-dien-1-olate.
| Compound Name | (1Z,4E)-1-ethoxy-2-ethoxycarbonyl-6-oxohepta-1,4-dien-1-olate |
|---|---|
| PubChem CID | 134861195 |
| Molecular Formula | C12H17O5- |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (1Z,4E)-1-ethoxy-2-ethoxycarbonyl-6-oxohepta-1,4-dien-1-olate |
| SMILES | CCOC(=O)/C(C/C=C/C(C)=O)=C(/[O-])OCC |
| InChI | InChI=1S/C12H18O5/c1-4-16-11(14)10(12(15)17-5-2)8-6-7-9(3)13/h6-7,14H,4-5,8H2,1-3H3/p-1/b7-6+,11-10- |
| InChIKey | NQHNMAGPSRKUOC-WFKFFMJQSA-M |
| XLogP | 0.69 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|