C12H20NiO4 — CID 134861249
carbanide;ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate;nickel(2+) (PubChem CID 134861249) has the molecular formula C12H20NiO4 and a molecular weight of 286.98 g/mol. Its IUPAC name is carbanide;ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate;nickel(2+).
| Compound Name | carbanide;ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate;nickel(2+) |
|---|---|
| PubChem CID | 134861249 |
| Molecular Formula | C12H20NiO4 |
| Molecular Weight | 286.98 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | carbanide;ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate;nickel(2+) |
| SMILES | [CH2-]/C=C\C/C(C(=O)OCC)=C(\O)OCC.[CH3-].[Ni+2] |
| InChI | InChI=1S/C11H17O4.CH3.Ni/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3;;/h4,7,12H,1,5-6,8H2,2-3H3;1H3;/q2*-1;+2/b7-4-,10-9-;; |
| InChIKey | COMTWUABHXYQBT-YXFSCZITSA-N |
| XLogP | 2.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.98 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|