C11H15O4+ — CID 138962829
methyl (2E)-2-[hydroxy(methoxy)methylidene]octa-4,7-dienoate (PubChem CID 138962829) has the molecular formula C11H15O4+ and a molecular weight of 211.24 g/mol. Its IUPAC name is methyl (2E)-2-[hydroxy(methoxy)methylidene]octa-4,7-dienoate.
| Compound Name | methyl (2E)-2-[hydroxy(methoxy)methylidene]octa-4,7-dienoate |
|---|---|
| PubChem CID | 138962829 |
| Molecular Formula | C11H15O4+ |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | methyl (2E)-2-[hydroxy(methoxy)methylidene]octa-4,7-dienoate |
| SMILES | C=C[CH+]C=CC/C(C(=O)OC)=C(/O)OC |
| InChI | InChI=1S/C11H14O4/c1-4-5-6-7-8-9(10(12)14-2)11(13)15-3/h4-7H,1,8H2,2-3H3/p+1 |
| InChIKey | VYXZNIAHXNFDGY-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|