C13H20O4 — CID 134963437
ethyl (2E)-2-[ethoxy(hydroxy)methylidene]-6-methylhepta-4,5-dienoate (PubChem CID 134963437) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl (2E)-2-[ethoxy(hydroxy)methylidene]-6-methylhepta-4,5-dienoate.
| Compound Name | ethyl (2E)-2-[ethoxy(hydroxy)methylidene]-6-methylhepta-4,5-dienoate |
|---|---|
| PubChem CID | 134963437 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethyl (2E)-2-[ethoxy(hydroxy)methylidene]-6-methylhepta-4,5-dienoate |
| SMILES | CCOC(=O)/C(CC=C=C(C)C)=C(\O)OCC |
| InChI | InChI=1S/C13H20O4/c1-5-16-12(14)11(13(15)17-6-2)9-7-8-10(3)4/h7,14H,5-6,9H2,1-4H3/b12-11+ |
| InChIKey | KICJJZWJQRXDCQ-VAWYXSNFSA-N |
| XLogP | 2.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|