C11H18O4 — CID 134861250
ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate (PubChem CID 134861250) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate.
| Compound Name | ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate |
|---|---|
| PubChem CID | 134861250 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl (Z,2Z)-2-[ethoxy(hydroxy)methylidene]hex-4-enoate |
| SMILES | C/C=C\C/C(C(=O)OCC)=C(\O)OCC |
| InChI | InChI=1S/C11H18O4/c1-4-7-8-9(10(12)14-5-2)11(13)15-6-3/h4,7,12H,5-6,8H2,1-3H3/b7-4-,10-9- |
| InChIKey | ROAVNQVKDZZTKB-NSPOTZJRSA-N |
| XLogP | 2.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|