C13H18O5 — CID 102576696
6-hydroxy-2,2-dimethyl-5-[(E)-4-prop-2-enoxybut-2-enyl]-1,3-dioxin-4-one (PubChem CID 102576696) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 6-hydroxy-2,2-dimethyl-5-[(E)-4-prop-2-enoxybut-2-enyl]-1,3-dioxin-4-one.
| Compound Name | 6-hydroxy-2,2-dimethyl-5-[(E)-4-prop-2-enoxybut-2-enyl]-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 102576696 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-hydroxy-2,2-dimethyl-5-[(E)-4-prop-2-enoxybut-2-enyl]-1,3-dioxin-4-one |
| SMILES | C=CCOC/C=C/CC1=C(O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C13H18O5/c1-4-8-16-9-6-5-7-10-11(14)17-13(2,3)18-12(10)15/h4-6,14H,1,7-9H2,2-3H3/b6-5+ |
| InChIKey | ONROTBLWROEFBH-AATRIKPKSA-N |
| XLogP | 2.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|