C11H15O4- — CID 101130253
2,2-dimethyl-5-(3-methylbut-2-enyl)-6-oxo-1,3-dioxin-4-olate (PubChem CID 101130253) has the molecular formula C11H15O4- and a molecular weight of 211.24 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylbut-2-enyl)-6-oxo-1,3-dioxin-4-olate.
| Compound Name | 2,2-dimethyl-5-(3-methylbut-2-enyl)-6-oxo-1,3-dioxin-4-olate |
|---|---|
| PubChem CID | 101130253 |
| Molecular Formula | C11H15O4- |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylbut-2-enyl)-6-oxo-1,3-dioxin-4-olate |
| SMILES | CC(C)=CCC1=C([O-])OC(C)(C)OC1=O |
| InChI | InChI=1S/C11H16O4/c1-7(2)5-6-8-9(12)14-11(3,4)15-10(8)13/h5,12H,6H2,1-4H3/p-1 |
| InChIKey | ORVWLMVYCQBNMC-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|