C10H12O4 — CID 163697262
(6S)-2-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undeca-2,9-dien-4-one (PubChem CID 163697262) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (6S)-2-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undeca-2,9-dien-4-one.
| Compound Name | (6S)-2-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undeca-2,9-dien-4-one |
|---|---|
| PubChem CID | 163697262 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (6S)-2-hydroxy-3-methyl-1,5-dioxaspiro[5.5]undeca-2,9-dien-4-one |
| SMILES | CC1=C(O)O[C@]2(CC=CCC2)OC1=O |
| InChI | InChI=1S/C10H12O4/c1-7-8(11)13-10(14-9(7)12)5-3-2-4-6-10/h2-3,11H,4-6H2,1H3/t10-/m1/s1 |
| InChIKey | JXYPEFMHXNECPL-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|