C13H20O4 — CID 143456648
5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one;ethane (PubChem CID 143456648) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one;ethane.
| Compound Name | 5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one;ethane |
|---|---|
| PubChem CID | 143456648 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one;ethane |
| SMILES | C=C/C=C/C1=C(O)OC(C)(CC)OC1=O.CC |
| InChI | InChI=1S/C11H14O4.C2H6/c1-4-6-7-8-9(12)14-11(3,5-2)15-10(8)13;1-2/h4,6-7,12H,1,5H2,2-3H3;1-2H3/b7-6+; |
| InChIKey | CZZDEERZTKOSAX-UHDJGPCESA-N |
| XLogP | 3.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|