C11H14O4 — CID 143456649
5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one (PubChem CID 143456649) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one.
| Compound Name | 5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 143456649 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 5-[(1E)-buta-1,3-dienyl]-2-ethyl-6-hydroxy-2-methyl-1,3-dioxin-4-one |
| SMILES | C=C/C=C/C1=C(O)OC(C)(CC)OC1=O |
| InChI | InChI=1S/C11H14O4/c1-4-6-7-8-9(12)14-11(3,5-2)15-10(8)13/h4,6-7,12H,1,5H2,2-3H3/b7-6+ |
| InChIKey | DAWFIBOHKXWAMV-VOTSOKGWSA-N |
| XLogP | 2.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|