C9H11O4- — CID 101130250
2,2-dimethyl-6-oxo-5-prop-2-enyl-1,3-dioxin-4-olate (PubChem CID 101130250) has the molecular formula C9H11O4- and a molecular weight of 183.18 g/mol. Its IUPAC name is 2,2-dimethyl-6-oxo-5-prop-2-enyl-1,3-dioxin-4-olate.
| Compound Name | 2,2-dimethyl-6-oxo-5-prop-2-enyl-1,3-dioxin-4-olate |
|---|---|
| PubChem CID | 101130250 |
| Molecular Formula | C9H11O4- |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2,2-dimethyl-6-oxo-5-prop-2-enyl-1,3-dioxin-4-olate |
| SMILES | C=CCC1=C([O-])OC(C)(C)OC1=O |
| InChI | InChI=1S/C9H12O4/c1-4-5-6-7(10)12-9(2,3)13-8(6)11/h4,10H,1,5H2,2-3H3/p-1 |
| InChIKey | WPFXSWNVDIXYLC-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|