C8H11O4- — CID 15204812
(1Z)-1-methoxy-2-methoxycarbonylpenta-1,4-dien-1-olate (PubChem CID 15204812) has the molecular formula C8H11O4- and a molecular weight of 171.17 g/mol. Its IUPAC name is (1Z)-1-methoxy-2-methoxycarbonylpenta-1,4-dien-1-olate.
| Compound Name | (1Z)-1-methoxy-2-methoxycarbonylpenta-1,4-dien-1-olate |
|---|---|
| PubChem CID | 15204812 |
| Molecular Formula | C8H11O4- |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | (1Z)-1-methoxy-2-methoxycarbonylpenta-1,4-dien-1-olate |
| SMILES | C=CC/C(C(=O)OC)=C(\[O-])OC |
| InChI | InChI=1S/C8H12O4/c1-4-5-6(7(9)11-2)8(10)12-3/h4,9H,1,5H2,2-3H3/p-1/b7-6- |
| InChIKey | BFXLPDRCPHOGCC-SREVYHEPSA-M |
| XLogP | -0.05 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|