C15H22O5 — CID 90724812
4-methoxybutyl 2-[4-(methoxymethoxy)cyclohexa-2,4-dien-1-ylidene]acetate (PubChem CID 90724812) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-methoxybutyl 2-[4-(methoxymethoxy)cyclohexa-2,4-dien-1-ylidene]acetate.
| Compound Name | 4-methoxybutyl 2-[4-(methoxymethoxy)cyclohexa-2,4-dien-1-ylidene]acetate |
|---|---|
| PubChem CID | 90724812 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-methoxybutyl 2-[4-(methoxymethoxy)cyclohexa-2,4-dien-1-ylidene]acetate |
| SMILES | COCCCCOC(=O)C=C1C=CC(OCOC)=CC1 |
| InChI | InChI=1S/C15H22O5/c1-17-9-3-4-10-19-15(16)11-13-5-7-14(8-6-13)20-12-18-2/h5,7-8,11H,3-4,6,9-10,12H2,1-2H3 |
| InChIKey | KASPSUPHFLFIHD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|