C13H18O4 — CID 164687135
3-(6-oxopyran-2-yl)propyl 2,2-dimethylpropanoate (PubChem CID 164687135) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 3-(6-oxopyran-2-yl)propyl 2,2-dimethylpropanoate.
| Compound Name | 3-(6-oxopyran-2-yl)propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 164687135 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-(6-oxopyran-2-yl)propyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCc1cccc(=O)o1 |
| InChI | InChI=1S/C13H18O4/c1-13(2,3)12(15)16-9-5-7-10-6-4-8-11(14)17-10/h4,6,8H,5,7,9H2,1-3H3 |
| InChIKey | YCUSWFOCPNERML-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|