C12H18O5 — CID 134861196
ethyl (E,2Z)-2-[ethoxy(hydroxy)methylidene]-6-oxohept-4-enoate (PubChem CID 134861196) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl (E,2Z)-2-[ethoxy(hydroxy)methylidene]-6-oxohept-4-enoate.
| Compound Name | ethyl (E,2Z)-2-[ethoxy(hydroxy)methylidene]-6-oxohept-4-enoate |
|---|---|
| PubChem CID | 134861196 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | ethyl (E,2Z)-2-[ethoxy(hydroxy)methylidene]-6-oxohept-4-enoate |
| SMILES | CCOC(=O)/C(C/C=C/C(C)=O)=C(/O)OCC |
| InChI | InChI=1S/C12H18O5/c1-4-16-11(14)10(12(15)17-5-2)8-6-7-9(3)13/h6-7,14H,4-5,8H2,1-3H3/b7-6+,11-10- |
| InChIKey | NQHNMAGPSRKUOC-WFKFFMJQSA-N |
| XLogP | 1.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|