About ethenylbenzene;rhodium
ethenylbenzene;rhodium (PubChem CID 134861199) has the molecular formula C8H7Rh-
and a molecular weight of 206.05 g/mol. Its IUPAC name is ethenylbenzene;rhodium.
Molecular Properties
| Compound Name | ethenylbenzene;rhodium |
| PubChem CID | 134861199 |
| Molecular Formula | C8H7Rh- |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | ethenylbenzene;rhodium |
| SMILES | [H]/[C-]=C\c1ccccc1.[Rh] |
| InChI | InChI=1S/C8H7.Rh/c1-2-8-6-4-3-5-7-8;/h1-7H;/q-1; |
| InChIKey | KOJKIVCRSGKSOP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethenylbenzene;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylbenzene;rhodium?
The IUPAC name of ethenylbenzene;rhodium (CID 134861199) is ethenylbenzene;rhodium.
What is the SMILES notation for ethenylbenzene;rhodium?
The canonical SMILES for ethenylbenzene;rhodium is [H]/[C-]=C\c1ccccc1.[Rh].
What is the InChIKey of ethenylbenzene;rhodium?
The InChIKey is KOJKIVCRSGKSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7.Rh/c1-2-8-6-4-3-5-7-8;/h1-7H;/q-1;.
What are the key properties of ethenylbenzene;rhodium?
ethenylbenzene;rhodium has a molecular weight of 206.05 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylbenzene;rhodium is sourced from PubChem (CID 134861199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).