About bromozinc(1+);ethenylbenzene
bromozinc(1+);ethenylbenzene (PubChem CID 15977272) has the molecular formula C8H7BrZn
and a molecular weight of 248.44 g/mol. Its IUPAC name is bromozinc(1+);ethenylbenzene.
Molecular Properties
| Compound Name | bromozinc(1+);ethenylbenzene |
| PubChem CID | 15977272 |
| Molecular Formula | C8H7BrZn |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 245.90 |
| IUPAC Name | bromozinc(1+);ethenylbenzene |
| SMILES | [H]/[C-]=C\c1ccccc1.[Zn+]Br |
| InChI | InChI=1S/C8H7.BrH.Zn/c1-2-8-6-4-3-5-7-8;;/h1-7H;1H;/q-1;;+2/p-1 |
| InChIKey | XTAPDCLUQXYAQC-UHFFFAOYSA-M |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);ethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);ethenylbenzene?
The IUPAC name of bromozinc(1+);ethenylbenzene (CID 15977272) is bromozinc(1+);ethenylbenzene.
What is the SMILES notation for bromozinc(1+);ethenylbenzene?
The canonical SMILES for bromozinc(1+);ethenylbenzene is [H]/[C-]=C\c1ccccc1.[Zn+]Br.
What is the InChIKey of bromozinc(1+);ethenylbenzene?
The InChIKey is XTAPDCLUQXYAQC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7.BrH.Zn/c1-2-8-6-4-3-5-7-8;;/h1-7H;1H;/q-1;;+2/p-1.
What are the key properties of bromozinc(1+);ethenylbenzene?
bromozinc(1+);ethenylbenzene has a molecular weight of 248.44 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);ethenylbenzene is sourced from PubChem (CID 15977272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).