C12H22N+ — CID 134861922
dimethyl-(2,2,3-trimethyl-3-prop-1-en-2-ylcyclobutylidene)azanium (PubChem CID 134861922) has the molecular formula C12H22N+ and a molecular weight of 180.31 g/mol. Its IUPAC name is dimethyl-(2,2,3-trimethyl-3-prop-1-en-2-ylcyclobutylidene)azanium.
| Compound Name | dimethyl-(2,2,3-trimethyl-3-prop-1-en-2-ylcyclobutylidene)azanium |
|---|---|
| PubChem CID | 134861922 |
| Molecular Formula | C12H22N+ |
| Molecular Weight | 180.31 g/mol |
| Exact Mass | 180.17 |
| IUPAC Name | dimethyl-(2,2,3-trimethyl-3-prop-1-en-2-ylcyclobutylidene)azanium |
| SMILES | C=C(C)C1(C)CC(=[N+](C)C)C1(C)C |
| InChI | InChI=1S/C12H22N/c1-9(2)12(5)8-10(13(6)7)11(12,3)4/h1,8H2,2-7H3/q+1 |
| InChIKey | QLIPRISTPKIZRL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|