About N-isothiocyanato-2,4-dimethylpentan-3-imine
N-isothiocyanato-2,4-dimethylpentan-3-imine (PubChem CID 134862053) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is N-isothiocyanato-2,4-dimethylpentan-3-imine.
Molecular Properties
| Compound Name | N-isothiocyanato-2,4-dimethylpentan-3-imine |
| PubChem CID | 134862053 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | N-isothiocyanato-2,4-dimethylpentan-3-imine |
| SMILES | CC(C)C(=NN=C=S)C(C)C |
| InChI | InChI=1S/C8H14N2S/c1-6(2)8(7(3)4)10-9-5-11/h6-7H,1-4H3 |
| InChIKey | IVSDOJBJWCRXJQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-isothiocyanato-2,4-dimethylpentan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-isothiocyanato-2,4-dimethylpentan-3-imine?
The IUPAC name of N-isothiocyanato-2,4-dimethylpentan-3-imine (CID 134862053) is N-isothiocyanato-2,4-dimethylpentan-3-imine.
What is the SMILES notation for N-isothiocyanato-2,4-dimethylpentan-3-imine?
The canonical SMILES for N-isothiocyanato-2,4-dimethylpentan-3-imine is CC(C)C(=NN=C=S)C(C)C.
What is the InChIKey of N-isothiocyanato-2,4-dimethylpentan-3-imine?
The InChIKey is IVSDOJBJWCRXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-6(2)8(7(3)4)10-9-5-11/h6-7H,1-4H3.
What are the key properties of N-isothiocyanato-2,4-dimethylpentan-3-imine?
N-isothiocyanato-2,4-dimethylpentan-3-imine has a molecular weight of 170.28 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-isothiocyanato-2,4-dimethylpentan-3-imine is sourced from PubChem (CID 134862053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).