About tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate
tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate (PubChem CID 134862279) has the molecular formula C19H37ClO3
and a molecular weight of 348.96 g/mol. Its IUPAC name is tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate.
Molecular Properties
| Compound Name | tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate |
| PubChem CID | 134862279 |
| Molecular Formula | C19H37ClO3 |
| Molecular Weight | 348.96 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@](C)(CO)CCCCCCCCCCl |
| InChI | InChI=1S/C19H37ClO3/c1-18(2,3)23-17(22)12-14-19(4,16-21)13-10-8-6-5-7-9-11-15-20/h21H,5-16H2,1-4H3/t19-/m1/s1 |
| InChIKey | AWZCUHMVZNSYAF-LJQANCHMSA-N |
| XLogP | 5.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.96 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate?
The IUPAC name of tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate (CID 134862279) is tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate.
What is the SMILES notation for tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate?
The canonical SMILES for tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate is CC(C)(C)OC(=O)CC[C@](C)(CO)CCCCCCCCCCl.
What is the InChIKey of tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate?
The InChIKey is AWZCUHMVZNSYAF-LJQANCHMSA-N. The full InChI is InChI=1S/C19H37ClO3/c1-18(2,3)23-17(22)12-14-19(4,16-21)13-10-8-6-5-7-9-11-15-20/h21H,5-16H2,1-4H3/t19-/m1/s1.
What are the key properties of tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate?
tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate has a molecular weight of 348.96 g/mol, XLogP of 5.47, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4R)-13-chloro-4-(hydroxymethyl)-4-methyltridecanoate is sourced from PubChem (CID 134862279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).