C13H12O3 — CID 134862464
(1S,2S,4R,6R)-4-phenyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one (PubChem CID 134862464) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (1S,2S,4R,6R)-4-phenyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one.
| Compound Name | (1S,2S,4R,6R)-4-phenyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
|---|---|
| PubChem CID | 134862464 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (1S,2S,4R,6R)-4-phenyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
| SMILES | O=C1[C@@H]2OC[C@@H](O2)[C@H]2C[C@@]12c1ccccc1 |
| InChI | InChI=1S/C13H12O3/c14-11-12-15-7-10(16-12)9-6-13(9,11)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2/t9-,10-,12-,13+/m1/s1 |
| InChIKey | OBWZBBDCMPPEAC-WFFHOREQSA-N |
| XLogP | 1.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |