C14H11FO4 — CID 39409857
(1S,2S,3R,4S,6R)-3-(4-fluorobenzoyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one (PubChem CID 39409857) has the molecular formula C14H11FO4 and a molecular weight of 262.24 g/mol. Its IUPAC name is (1S,2S,3R,4S,6R)-3-(4-fluorobenzoyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one.
| Compound Name | (1S,2S,3R,4S,6R)-3-(4-fluorobenzoyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
|---|---|
| PubChem CID | 39409857 |
| Molecular Formula | C14H11FO4 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (1S,2S,3R,4S,6R)-3-(4-fluorobenzoyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
| SMILES | O=C1[C@@H]2OC[C@@H](O2)[C@@H]2[C@H]1[C@@H]2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11FO4/c15-7-3-1-6(2-4-7)12(16)10-9-8-5-18-14(19-8)13(17)11(9)10/h1-4,8-11,14H,5H2/t8-,9+,10-,11+,14-/m1/s1 |
| InChIKey | XLWJCKJOMYVUEB-AHMQBVQWSA-N |
| XLogP | 1.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |