C19H14N4O8S — CID 124767452
3,5-dinitro-N-[(E)-[(1S,2S,3R,4R,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]benzamide (PubChem CID 124767452) has the molecular formula C19H14N4O8S and a molecular weight of 458.41 g/mol. Its IUPAC name is 3,5-dinitro-N-[(E)-[(1S,2S,3R,4R,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]benzamide.
| Compound Name | 3,5-dinitro-N-[(E)-[(1S,2S,3R,4R,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 124767452 |
| Molecular Formula | C19H14N4O8S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 3,5-dinitro-N-[(E)-[(1S,2S,3R,4R,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]benzamide |
| SMILES | O=C(N/N=C1/[C@H]2OC[C@@H](O2)[C@@H]2[C@H](C(=O)c3cccs3)[C@H]12)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N4O8S/c24-17(12-2-1-3-32-12)15-13-11-7-30-19(31-11)16(14(13)15)20-21-18(25)8-4-9(22(26)27)6-10(5-8)23(28)29/h1-6,11,13-15,19H,7H2,(H,21,25)/b20-16+/t11-,13+,14-,15+,19+/m1/s1 |
| InChIKey | OZCNKKYIDMVWOO-IIQOCUNCSA-N |
| XLogP | 2.15 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|