C21H16N4O8 — CID 129437922
N-[[(1S,2S,3S,4S,6S)-3-benzoyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]-3,5-dinitrobenzamide (PubChem CID 129437922) has the molecular formula C21H16N4O8 and a molecular weight of 452.38 g/mol. Its IUPAC name is N-[[(1S,2S,3S,4S,6S)-3-benzoyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]-3,5-dinitrobenzamide.
| Compound Name | N-[[(1S,2S,3S,4S,6S)-3-benzoyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 129437922 |
| Molecular Formula | C21H16N4O8 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-[[(1S,2S,3S,4S,6S)-3-benzoyl-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-ylidene]amino]-3,5-dinitrobenzamide |
| SMILES | O=C(NN=C1[C@H]2OC[C@@H](O2)[C@H]2[C@H]1[C@@H]2C(=O)c1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16N4O8/c26-19(10-4-2-1-3-5-10)17-15-14-9-32-21(33-14)18(16(15)17)22-23-20(27)11-6-12(24(28)29)8-13(7-11)25(30)31/h1-8,14-17,21H,9H2,(H,23,27)/t14-,15+,16+,17-,21+/m1/s1 |
| InChIKey | CIZRBZQICZJVBQ-FMWYQGOYSA-N |
| XLogP | 2.09 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|