C16H15N5O5 — CID 18555595
N-[(E)-[(1R,2S,5S)-2-(3-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide (PubChem CID 18555595) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is N-[(E)-[(1R,2S,5S)-2-(3-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide.
| Compound Name | N-[(E)-[(1R,2S,5S)-2-(3-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 18555595 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[(E)-[(1R,2S,5S)-2-(3-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide |
| SMILES | O=C(N/N=C1\C[C@H](n2ccc([N+](=O)[O-])n2)[C@@H]2CO[C@H]1O2)c1ccccc1 |
| InChI | InChI=1S/C16H15N5O5/c22-15(10-4-2-1-3-5-10)18-17-11-8-12(13-9-25-16(11)26-13)20-7-6-14(19-20)21(23)24/h1-7,12-13,16H,8-9H2,(H,18,22)/b17-11+/t12-,13-,16-/m0/s1 |
| InChIKey | IPGNXKPZYGKRQD-RUZYDWBQSA-N |
| XLogP | 1.26 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|