C16H14N6O7 — CID 98189998
2-nitro-N-[(E)-[(1R,2S,5R)-2-(4-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide (PubChem CID 98189998) has the molecular formula C16H14N6O7 and a molecular weight of 402.32 g/mol. Its IUPAC name is 2-nitro-N-[(E)-[(1R,2S,5R)-2-(4-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide.
| Compound Name | 2-nitro-N-[(E)-[(1R,2S,5R)-2-(4-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 98189998 |
| Molecular Formula | C16H14N6O7 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-nitro-N-[(E)-[(1R,2S,5R)-2-(4-nitropyrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide |
| SMILES | O=C(N/N=C1\C[C@H](n2cc([N+](=O)[O-])cn2)[C@@H]2CO[C@@H]1O2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N6O7/c23-15(10-3-1-2-4-12(10)22(26)27)19-18-11-5-13(14-8-28-16(11)29-14)20-7-9(6-17-20)21(24)25/h1-4,6-7,13-14,16H,5,8H2,(H,19,23)/b18-11+/t13-,14-,16+/m0/s1 |
| InChIKey | PBTBUMVHRXPUBB-CWKTUHNBSA-N |
| XLogP | 1.17 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|