C15H13N7O7 — CID 41065212
2-nitro-N-[(E)-[(1S,2S,5R)-2-(3-nitro-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide (PubChem CID 41065212) has the molecular formula C15H13N7O7 and a molecular weight of 403.31 g/mol. Its IUPAC name is 2-nitro-N-[(E)-[(1S,2S,5R)-2-(3-nitro-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide.
| Compound Name | 2-nitro-N-[(E)-[(1S,2S,5R)-2-(3-nitro-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 41065212 |
| Molecular Formula | C15H13N7O7 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 2-nitro-N-[(E)-[(1S,2S,5R)-2-(3-nitro-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]benzamide |
| SMILES | O=C(N/N=C1\C[C@H](n2cnc([N+](=O)[O-])n2)[C@H]2CO[C@@H]1O2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N7O7/c23-13(8-3-1-2-4-10(8)21(24)25)18-17-9-5-11(12-6-28-14(9)29-12)20-7-16-15(19-20)22(26)27/h1-4,7,11-12,14H,5-6H2,(H,18,23)/b17-9+/t11-,12+,14+/m0/s1 |
| InChIKey | HGSMKWQRSIYGGO-QLIVHTOSSA-N |
| XLogP | 0.57 |
| TPSA | 176.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|