C14H15N7O2S — CID 4320165
[[2-(5-phenyltetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea (PubChem CID 4320165) has the molecular formula C14H15N7O2S and a molecular weight of 345.39 g/mol. Its IUPAC name is [[2-(5-phenyltetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea.
| Compound Name | [[2-(5-phenyltetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 4320165 |
| Molecular Formula | C14H15N7O2S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [[2-(5-phenyltetrazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea |
| SMILES | NC(=S)NN=C1CC(n2nnnc2-c2ccccc2)C2COC1O2 |
| InChI | InChI=1S/C14H15N7O2S/c15-14(24)18-16-9-6-10(11-7-22-13(9)23-11)21-12(17-19-20-21)8-4-2-1-3-5-8/h1-5,10-11,13H,6-7H2,(H3,15,18,24) |
| InChIKey | VADMSKYWFQXCTI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|