C21H15N5O9 — CID 16761121
N-[(Z)-[(1S,2S,5R)-2-(1,3-dioxoisoindol-2-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]-3,5-dinitrobenzamide (PubChem CID 16761121) has the molecular formula C21H15N5O9 and a molecular weight of 481.38 g/mol. Its IUPAC name is N-[(Z)-[(1S,2S,5R)-2-(1,3-dioxoisoindol-2-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]-3,5-dinitrobenzamide.
| Compound Name | N-[(Z)-[(1S,2S,5R)-2-(1,3-dioxoisoindol-2-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 16761121 |
| Molecular Formula | C21H15N5O9 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | N-[(Z)-[(1S,2S,5R)-2-(1,3-dioxoisoindol-2-yl)-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]-3,5-dinitrobenzamide |
| SMILES | O=C(N/N=C1/C[C@H](N2C(=O)c3ccccc3C2=O)[C@H]2CO[C@@H]1O2)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15N5O9/c27-18(10-5-11(25(30)31)7-12(6-10)26(32)33)23-22-15-8-16(17-9-34-21(15)35-17)24-19(28)13-3-1-2-4-14(13)20(24)29/h1-7,16-17,21H,8-9H2,(H,23,27)/b22-15-/t16-,17+,21+/m0/s1 |
| InChIKey | FJURCDYCERCTFV-MFAHJXEPSA-N |
| XLogP | 1.40 |
| TPSA | 183.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|