C12H10O4S — CID 124787347
(1S,2R,3S,4S,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one (PubChem CID 124787347) has the molecular formula C12H10O4S and a molecular weight of 250.27 g/mol. Its IUPAC name is (1S,2R,3S,4S,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one.
| Compound Name | (1S,2R,3S,4S,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
|---|---|
| PubChem CID | 124787347 |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | (1S,2R,3S,4S,6S)-3-(thiophene-2-carbonyl)-7,9-dioxatricyclo[4.2.1.02,4]nonan-5-one |
| SMILES | O=C(c1cccs1)[C@@H]1[C@H]2C(=O)[C@H]3OC[C@@H](O3)[C@@H]12 |
| InChI | InChI=1S/C12H10O4S/c13-10(6-2-1-3-17-6)8-7-5-4-15-12(16-5)11(14)9(7)8/h1-3,5,7-9,12H,4H2/t5-,7+,8+,9+,12+/m1/s1 |
| InChIKey | ACMDDNLMMKJLPC-GCLGEZPSSA-N |
| XLogP | 1.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |