C11H12O3S — CID 155934347
(3S)-5,5-dimethyl-3-(thiophene-2-carbonyl)oxolan-2-one (PubChem CID 155934347) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is (3S)-5,5-dimethyl-3-(thiophene-2-carbonyl)oxolan-2-one.
| Compound Name | (3S)-5,5-dimethyl-3-(thiophene-2-carbonyl)oxolan-2-one |
|---|---|
| PubChem CID | 155934347 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | (3S)-5,5-dimethyl-3-(thiophene-2-carbonyl)oxolan-2-one |
| SMILES | CC1(C)C[C@@H](C(=O)c2cccs2)C(=O)O1 |
| InChI | InChI=1S/C11H12O3S/c1-11(2)6-7(10(13)14-11)9(12)8-4-3-5-15-8/h3-5,7H,6H2,1-2H3/t7-/m0/s1 |
| InChIKey | KVOSJRHNOFKCLX-ZETCQYMHSA-N |
| XLogP | 2.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|