C19H15ClO5S — CID 102478077
(1S,2R)-1-(4-chlorophenyl)-6,6-dimethyl-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione (PubChem CID 102478077) has the molecular formula C19H15ClO5S and a molecular weight of 390.84 g/mol. Its IUPAC name is (1S,2R)-1-(4-chlorophenyl)-6,6-dimethyl-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione.
| Compound Name | (1S,2R)-1-(4-chlorophenyl)-6,6-dimethyl-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
|---|---|
| PubChem CID | 102478077 |
| Molecular Formula | C19H15ClO5S |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | (1S,2R)-1-(4-chlorophenyl)-6,6-dimethyl-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)[C@H](C(=O)c1cccs1)[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClO5S/c1-18(2)24-16(22)19(17(23)25-18)13(10-5-7-11(20)8-6-10)14(19)15(21)12-4-3-9-26-12/h3-9,13-14H,1-2H3/t13-,14+/m1/s1 |
| InChIKey | KMQRVRPGOOGEGV-KGLIPLIRSA-N |
| XLogP | 3.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|