C20H18O5S — CID 102478075
(1S,2R)-6,6-dimethyl-1-(4-methylphenyl)-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione (PubChem CID 102478075) has the molecular formula C20H18O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is (1S,2R)-6,6-dimethyl-1-(4-methylphenyl)-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione.
| Compound Name | (1S,2R)-6,6-dimethyl-1-(4-methylphenyl)-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
|---|---|
| PubChem CID | 102478075 |
| Molecular Formula | C20H18O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (1S,2R)-6,6-dimethyl-1-(4-methylphenyl)-2-(thiophene-2-carbonyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
| SMILES | Cc1ccc([C@@H]2[C@@H](C(=O)c3cccs3)C23C(=O)OC(C)(C)OC3=O)cc1 |
| InChI | InChI=1S/C20H18O5S/c1-11-6-8-12(9-7-11)14-15(16(21)13-5-4-10-26-13)20(14)17(22)24-19(2,3)25-18(20)23/h4-10,14-15H,1-3H3/t14-,15+/m1/s1 |
| InChIKey | NXAFSBXWYXAADT-CABCVRRESA-N |
| XLogP | 3.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|