C20H13N3O6S — CID 92971559
3,5-dinitro-N-[4-[(Z)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl]benzamide (PubChem CID 92971559) has the molecular formula C20H13N3O6S and a molecular weight of 423.41 g/mol. Its IUPAC name is 3,5-dinitro-N-[4-[(Z)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl]benzamide.
| Compound Name | 3,5-dinitro-N-[4-[(Z)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 92971559 |
| Molecular Formula | C20H13N3O6S |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 3,5-dinitro-N-[4-[(Z)-3-oxo-3-thiophen-2-ylprop-1-enyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(/C=C\C(=O)c2cccs2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13N3O6S/c24-18(19-2-1-9-30-19)8-5-13-3-6-15(7-4-13)21-20(25)14-10-16(22(26)27)12-17(11-14)23(28)29/h1-12H,(H,21,25)/b8-5- |
| InChIKey | VPXBBPBLBQPDFB-YVMONPNESA-N |
| XLogP | 4.71 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|