C9H16O4 — CID 134862961
methyl (4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate (PubChem CID 134862961) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is methyl (4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate.
| Compound Name | methyl (4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate |
|---|---|
| PubChem CID | 134862961 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | methyl (4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate |
| SMILES | COC(=O)C1[C@H](C)CCOC1(C)O |
| InChI | InChI=1S/C9H16O4/c1-6-4-5-13-9(2,11)7(6)8(10)12-3/h6-7,11H,4-5H2,1-3H3/t6-,7?,9?/m1/s1 |
| InChIKey | AALPQWDLFLXVJT-SXJRXYEXSA-N |
| XLogP | 0.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |