C12H22O4 — CID 134861767
tert-butyl (3R,4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate (PubChem CID 134861767) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is tert-butyl (3R,4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate.
| Compound Name | tert-butyl (3R,4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate |
|---|---|
| PubChem CID | 134861767 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | tert-butyl (3R,4R)-2-hydroxy-2,4-dimethyloxane-3-carboxylate |
| SMILES | C[C@@H]1CCOC(C)(O)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22O4/c1-8-6-7-15-12(5,14)9(8)10(13)16-11(2,3)4/h8-9,14H,6-7H2,1-5H3/t8-,9+,12?/m1/s1 |
| InChIKey | UPRVEXLNXNUZEH-RLBMWQAVSA-N |
| XLogP | 1.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |