C12H22O5 — CID 14915898
ethyl 5-hydroxy-2-(2-methyl-1,3-dioxan-2-yl)pentanoate (PubChem CID 14915898) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is ethyl 5-hydroxy-2-(2-methyl-1,3-dioxan-2-yl)pentanoate.
| Compound Name | ethyl 5-hydroxy-2-(2-methyl-1,3-dioxan-2-yl)pentanoate |
|---|---|
| PubChem CID | 14915898 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | ethyl 5-hydroxy-2-(2-methyl-1,3-dioxan-2-yl)pentanoate |
| SMILES | CCOC(=O)C(CCCO)C1(C)OCCCO1 |
| InChI | InChI=1S/C12H22O5/c1-3-15-11(14)10(6-4-7-13)12(2)16-8-5-9-17-12/h10,13H,3-9H2,1-2H3 |
| InChIKey | YNASDNICNQCXQT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |