C14H24O2Si — CID 134863497
tert-butyl-dimethyl-(1,3,6,7-tetrahydro-2-benzofuran-5-yloxy)silane (PubChem CID 134863497) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1,3,6,7-tetrahydro-2-benzofuran-5-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(1,3,6,7-tetrahydro-2-benzofuran-5-yloxy)silane |
|---|---|
| PubChem CID | 134863497 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | tert-butyl-dimethyl-(1,3,6,7-tetrahydro-2-benzofuran-5-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2=C(CC1)COC2 |
| InChI | InChI=1S/C14H24O2Si/c1-14(2,3)17(4,5)16-13-7-6-11-9-15-10-12(11)8-13/h8H,6-7,9-10H2,1-5H3 |
| InChIKey | LEXCJXLKEQWODI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|