C16H30O2Si — CID 11414876
tert-butyl-dimethyl-[3-(4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl)propoxy]silane (PubChem CID 11414876) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-(4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl)propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-(4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl)propoxy]silane |
|---|---|
| PubChem CID | 11414876 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | tert-butyl-dimethyl-[3-(4-prop-1-en-2-yl-2,5-dihydrofuran-2-yl)propoxy]silane |
| SMILES | C=C(C)C1=CC(CCCO[Si](C)(C)C(C)(C)C)OC1 |
| InChI | InChI=1S/C16H30O2Si/c1-13(2)14-11-15(17-12-14)9-8-10-18-19(6,7)16(3,4)5/h11,15H,1,8-10,12H2,2-7H3 |
| InChIKey | RKRRYDYNIHUDCC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|