C32H58O2Si — CID 11420696
tert-butyl-[(2E,6E,10E,14E)-9-methoxy-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]-dimethylsilane (PubChem CID 11420696) has the molecular formula C32H58O2Si and a molecular weight of 502.90 g/mol. Its IUPAC name is tert-butyl-[(2E,6E,10E,14E)-9-methoxy-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E,10E,14E)-9-methoxy-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11420696 |
| Molecular Formula | C32H58O2Si |
| Molecular Weight | 502.90 g/mol |
| Exact Mass | 502.42 |
| IUPAC Name | tert-butyl-[(2E,6E,10E,14E)-9-methoxy-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]-dimethylsilane |
| SMILES | COC(/C=C(\C)CC/C=C(\C)CCC=C(C)C)C/C(C)=C/CC/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H58O2Si/c1-26(2)16-13-17-27(3)18-14-20-29(5)24-31(33-10)25-30(6)21-15-19-28(4)22-23-34-35(11,12)32(7,8)9/h16,18,21-22,24,31H,13-15,17,19-20,23,25H2,1-12H3/b27-18+,28-22+,29-24+,30-21+ |
| InChIKey | KSDWWTBYCSTJAY-PPCOIVHTSA-N |
| XLogP | 10.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.90 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|