C21H40O2Si — CID 11068169
tert-butyl-[(5E)-9-ethenoxy-6,10-dimethylundeca-5,10-dienoxy]-dimethylsilane (PubChem CID 11068169) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is tert-butyl-[(5E)-9-ethenoxy-6,10-dimethylundeca-5,10-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5E)-9-ethenoxy-6,10-dimethylundeca-5,10-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11068169 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | tert-butyl-[(5E)-9-ethenoxy-6,10-dimethylundeca-5,10-dienoxy]-dimethylsilane |
| SMILES | C=COC(CC/C(C)=C/CCCCO[Si](C)(C)C(C)(C)C)C(=C)C |
| InChI | InChI=1S/C21H40O2Si/c1-10-22-20(18(2)3)16-15-19(4)14-12-11-13-17-23-24(8,9)21(5,6)7/h10,14,20H,1-2,11-13,15-17H2,3-9H3/b19-14+ |
| InChIKey | SKQITTJFBTWBLH-XMHGGMMESA-N |
| XLogP | 7.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|