C18H34O2Si — CID 10686438
tert-butyl-dimethyl-[(1S,2S)-2-(3-methylbut-2-enoxy)cyclohept-3-en-1-yl]oxysilane (PubChem CID 10686438) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2S)-2-(3-methylbut-2-enoxy)cyclohept-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,2S)-2-(3-methylbut-2-enoxy)cyclohept-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 10686438 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2S)-2-(3-methylbut-2-enoxy)cyclohept-3-en-1-yl]oxysilane |
| SMILES | CC(C)=CCO[C@H]1C=CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O2Si/c1-15(2)13-14-19-16-11-9-8-10-12-17(16)20-21(6,7)18(3,4)5/h9,11,13,16-17H,8,10,12,14H2,1-7H3/t16-,17-/m0/s1 |
| InChIKey | IWKGAQBFQMACLL-IRXDYDNUSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|